EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O9P |
| Net Charge | -2 |
| Average Mass | 362.191 |
| Monoisotopic Mass | 362.02746 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/p-2/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DCTLYFZHFGENCW-UUOKFMHZSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-xanthylate(2−) (CHEBI:57464) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5'-xanthylate(2−) (CHEBI:57464) has role human metabolite (CHEBI:77746) |
| 5'-xanthylate(2−) (CHEBI:57464) is a nucleoside 5'-monophosphate(2−) (CHEBI:58043) |
| 5'-xanthylate(2−) (CHEBI:57464) is conjugate base of 5'-xanthylic acid (CHEBI:15652) |
| Incoming Relation(s) |
| 5'-xanthylic acid (CHEBI:15652) is conjugate acid of 5'-xanthylate(2−) (CHEBI:57464) |
| IUPAC Name |
|---|
| 5'-O-phosphonatoxanthosine |
| Synonym | Source |
|---|---|
| 5'-xanthylate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| XMP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1082168 | Gmelin |
| Beilstein:11352170 | Beilstein |