EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N4O9P |
| Net Charge | 0 |
| Average Mass | 364.207 |
| Monoisotopic Mass | 364.04201 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DCTLYFZHFGENCW-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-xanthylic acid (CHEBI:15652) has role Escherichia coli metabolite (CHEBI:76971) |
| 5'-xanthylic acid (CHEBI:15652) has role metabolite (CHEBI:25212) |
| 5'-xanthylic acid (CHEBI:15652) has role mouse metabolite (CHEBI:75771) |
| 5'-xanthylic acid (CHEBI:15652) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| 5'-xanthylic acid (CHEBI:15652) is a xanthosine 5'-phosphate (CHEBI:53012) |
| 5'-xanthylic acid (CHEBI:15652) is conjugate acid of 5'-xanthylate(2−) (CHEBI:57464) |
| Incoming Relation(s) |
| urate D-ribonucleotide (CHEBI:17145) has functional parent 5'-xanthylic acid (CHEBI:15652) |
| 5'-xanthylate(2−) (CHEBI:57464) is conjugate base of 5'-xanthylic acid (CHEBI:15652) |
| IUPAC Name |
|---|
| 5'-xanthylic acid |
| Synonyms | Source |
|---|---|
| (9-D-ribosylxanthine)-5'-phosphate | ChEBI |
| (9-D-Ribosylxanthine)-5'-phosphate | KEGG COMPOUND |
| Xanthosine 5'-phosphate | KEGG COMPOUND |
| xanthosine monophosphate | ChEBI |
| Xanthylic acid | KEGG COMPOUND |
| XMP | KEGG COMPOUND |
| Citations |
|---|