EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC[NH2+]CC(=O)[O-] |
| InChI | InChI=1S/C4H9NO2/c1-2-5-3-4(6)7/h5H,2-3H2,1H3,(H,6,7) |
| InChIKey | YPIGGYHFMKJNKV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethylglycine zwitterion (CHEBI:57440) is a N-alkylglycine zwitterion (CHEBI:66884) |
| N-ethylglycine zwitterion (CHEBI:57440) is tautomer of N-ethylglycine (CHEBI:15620) |
| Incoming Relation(s) |
| N-ethylglycine (CHEBI:15620) is tautomer of N-ethylglycine zwitterion (CHEBI:57440) |
| IUPAC Name |
|---|
| (ethylazaniumyl)acetate |
| Synonyms | Source |
|---|---|
| 2-(ethylazaniumyl)acetate | ChEBI |
| (ethylammonio)acetate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-ethylglycine | UniProt |