EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CCNCC(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-2-5-3-4(6)7/h5H,2-3H2,1H3,(H,6,7) |
| InChIKey | YPIGGYHFMKJNKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethylglycine (CHEBI:15620) is a N-alkylglycine (CHEBI:66933) |
| N-ethylglycine (CHEBI:15620) is tautomer of N-ethylglycine zwitterion (CHEBI:57440) |
| Incoming Relation(s) |
| N-ethylglycine zwitterion (CHEBI:57440) is tautomer of N-ethylglycine (CHEBI:15620) |
| IUPAC Name |
|---|
| N-ethylglycine |
| Synonyms | Source |
|---|---|
| EtGly | ChEBI |
| N-Ethylglycine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11735 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1041563 | Beilstein |