EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O2 |
| Net Charge | +1 |
| Average Mass | 147.198 |
| Monoisotopic Mass | 147.11280 |
| SMILES | [NH3+]CCC[C@H]([NH3+])CC(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c7-3-1-2-5(8)4-6(9)10/h5H,1-4,7-8H2,(H,9,10)/p+1/t5-/m0/s1 |
| InChIKey | QKEWQOJCHPFEAF-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3,6-diammoniohexanoate (CHEBI:57434) is a amino-acid cation (CHEBI:33703) |
| (3S)-3,6-diammoniohexanoate (CHEBI:57434) is conjugate acid of (3S)-3,6-diaminohexanoic acid (CHEBI:15613) |
| Incoming Relation(s) |
| (3S)-3,6-diaminohexanoic acid (CHEBI:15613) is conjugate base of (3S)-3,6-diammoniohexanoate (CHEBI:57434) |
| IUPAC Name |
|---|
| (3S)-3,6-diazaniumylhexanoate |
| UniProt Name | Source |
|---|---|
| (3S)-3,6-diaminohexanoate | UniProt |