EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCC[C@H](N)CC(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-3-1-2-5(8)4-6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | QKEWQOJCHPFEAF-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3,6-diaminohexanoic acid (CHEBI:15613) has functional parent hexanoic acid (CHEBI:30776) |
| (3S)-3,6-diaminohexanoic acid (CHEBI:15613) is a diamino acid (CHEBI:35987) |
| (3S)-3,6-diaminohexanoic acid (CHEBI:15613) is a β-amino acid (CHEBI:33706) |
| (3S)-3,6-diaminohexanoic acid (CHEBI:15613) is conjugate base of (3S)-3,6-diammoniohexanoate (CHEBI:57434) |
| Incoming Relation(s) |
| (3S)-3,6-diammoniohexanoate (CHEBI:57434) is conjugate acid of (3S)-3,6-diaminohexanoic acid (CHEBI:15613) |
| IUPAC Name |
|---|
| (3S)-3,6-diaminohexanoic acid |
| Synonyms | Source |
|---|---|
| (3S)-3,6-Diaminohexanoate | KEGG COMPOUND |
| (3S)-3,6-diaminohexanoic acid | ChEBI |
| L-beta-lysine | ChEBI |
| L-beta-Lysine | KEGG COMPOUND |