EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | -2 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03827 |
| SMILES | CC(C)(C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O5/c1-6(2,5(10)11)3(7)4(8)9/h3,7H,1-2H3,(H,8,9)(H,10,11)/p-2/t3-/m0/s1 |
| InChIKey | KSAIICDEQGEQBK-VKHMYHEASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3,3-dimethylmalate(2−) (CHEBI:57424) is a dicarboxylic acid dianion (CHEBI:28965) |
| (R)-3,3-dimethylmalate(2−) (CHEBI:57424) is conjugate base of (R)-3,3-dimethylmalic acid (CHEBI:15587) |
| Incoming Relation(s) |
| (R)-3,3-dimethylmalic acid (CHEBI:15587) is conjugate acid of (R)-3,3-dimethylmalate(2−) (CHEBI:57424) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-2,2-dimethylbutanedioate |
| Synonym | Source |
|---|---|
| (R)-3-hydroxy-2,2-dimethylsuccinate | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-3,3-dimethylmalate | UniProt |