EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | CC(C)(C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O5/c1-6(2,5(10)11)3(7)4(8)9/h3,7H,1-2H3,(H,8,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | KSAIICDEQGEQBK-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3,3-dimethylmalic acid (CHEBI:15587) has functional parent succinic acid (CHEBI:15741) |
| (R)-3,3-dimethylmalic acid (CHEBI:15587) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| (R)-3,3-dimethylmalic acid (CHEBI:15587) is a dicarboxylic fatty acid (CHEBI:189840) |
| (R)-3,3-dimethylmalic acid (CHEBI:15587) is conjugate acid of (R)-3,3-dimethylmalate(2−) (CHEBI:57424) |
| Incoming Relation(s) |
| (R)-3,3-dimethylmalate(2−) (CHEBI:57424) is conjugate base of (R)-3,3-dimethylmalic acid (CHEBI:15587) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-2,2-dimethylbutanedioic acid |
| Synonyms | Source |
|---|---|
| (R)-3,3-dimethylmalate | ChEBI |
| (R)-3,3-Dimethylmalate | KEGG COMPOUND |