EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H40N4O8 |
| Net Charge | -4 |
| Average Mass | 656.736 |
| Monoisotopic Mass | 656.28681 |
| SMILES | Cc1c2nc(c1CCC(=O)[O-])Cc1nc(c(CCC(=O)[O-])c1C)Cc1nc(c(CCC(=O)[O-])c1C)Cc1nc(c(C)c1CCC(=O)[O-])C2 |
| InChI | InChI=1S/C36H44N4O8/c1-17-21(5-9-33(41)42)29-14-27-19(3)22(6-10-34(43)44)30(39-27)15-28-20(4)24(8-12-36(47)48)32(40-28)16-31-23(7-11-35(45)46)18(2)26(38-31)13-25(17)37-29/h37-40H,5-16H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48)/p-4 |
| InChIKey | NIUVHXTXUXOFEB-UHFFFAOYSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coproporphyrinogen III(4−) (CHEBI:57309) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| coproporphyrinogen III(4−) (CHEBI:57309) has role human metabolite (CHEBI:77746) |
| coproporphyrinogen III(4−) (CHEBI:57309) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| coproporphyrinogen III(4−) (CHEBI:57309) is conjugate base of coproporphyrinogen III (CHEBI:15439) |
| Incoming Relation(s) |
| coproporphyrinogen III (CHEBI:15439) is conjugate acid of coproporphyrinogen III(4−) (CHEBI:57309) |
| IUPAC Name |
|---|
| 3,8,13,17-tetramethyl-5,10,15,20,22,24-hexahydroporphyrin-2,7,12,18-tetrapropanoate |
| UniProt Name | Source |
|---|---|
| coproporphyrinogen III | UniProt |