EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15439 - coproporphyrinogen III
| Formula | C36H44N4O8 |
| Net Charge | 0 |
| Average Mass | 660.768 |
| Monoisotopic Mass | 660.31591 |
| SMILES | Cc1c2nc(c1CCC(=O)O)Cc1nc(c(CCC(=O)O)c1C)Cc1nc(c(CCC(=O)O)c1C)Cc1nc(c(C)c1CCC(=O)O)C2 |
| InChI | InChI=1S/C36H44N4O8/c1-17-21(5-9-33(41)42)29-14-27-19(3)22(6-10-34(43)44)30(39-27)15-28-20(4)24(8-12-36(47)48)32(40-28)16-31-23(7-11-35(45)46)18(2)26(38-31)13-25(17)37-29/h37-40H,5-16H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | NIUVHXTXUXOFEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coproporphyrinogen III (CHEBI:15439) has role Escherichia coli metabolite (CHEBI:76971) |
| coproporphyrinogen III (CHEBI:15439) has role mouse metabolite (CHEBI:75771) |
| coproporphyrinogen III (CHEBI:15439) is a coproporphyrinogen (CHEBI:15438) |
| coproporphyrinogen III (CHEBI:15439) is conjugate acid of coproporphyrinogen III(4−) (CHEBI:57309) |
| Incoming Relation(s) |
| coproporphyrinogen III(4−) (CHEBI:57309) is conjugate base of coproporphyrinogen III (CHEBI:15439) |
| IUPAC Name |
|---|
| 3,8,13,17-tetramethyl-5,10,15,20,22,24-hexahydroporphyrin-2,7,12,18-tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| Coproporphyrinogen III | KEGG COMPOUND |
| 3,8,13,17-tetramethyl-5,10,15,20,22,24-hexahydroporphyrin-2,7,12,18-tetrapropionic acid | JCBN |
| COPROPORPHYRIN III | PDBeChem |
| 5,10,15,20,22,24-hexahydro-3,8,13,17-tetramethyl-21H,23H-porphine-2,7,12,18-tetrapropanoic acid | ChemIDplus |