EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N4O4 |
| Net Charge | -2 |
| Average Mass | 566.702 |
| Monoisotopic Mass | 566.29040 |
| SMILES | C=Cc1c2nc(c1C)Cc1nc(c(CCC(=O)[O-])c1C)Cc1nc(c(C)c1CCC(=O)[O-])Cc1nc(c(C)c1C=C)C2 |
| InChI | InChI=1S/C34H40N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,35-38H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42)/p-2 |
| InChIKey | UHSGPDMIQQYNAX-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoporphyrinogen(2−) (CHEBI:57307) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| protoporphyrinogen(2−) (CHEBI:57307) has role human metabolite (CHEBI:77746) |
| protoporphyrinogen(2−) (CHEBI:57307) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| protoporphyrinogen(2−) (CHEBI:57307) is conjugate base of protoporphyrinogen (CHEBI:15435) |
| Incoming Relation(s) |
| protoporphyrinogen (CHEBI:15435) is conjugate acid of protoporphyrinogen(2−) (CHEBI:57307) |
| IUPAC Name |
|---|
| 3,3'-(8,13-diethynyl-3,7,12,17-tetramethyl-5,10,15,20,22,24-hexahydroporphyrin-2,18-diyl)dipropanoate |
| UniProt Name | Source |
|---|---|
| protoporphyrinogen IX | UniProt |