EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H40N4O4 |
| Net Charge | 0 |
| Average Mass | 568.718 |
| Monoisotopic Mass | 568.30496 |
| SMILES | C=Cc1c2nc(c1C)Cc1nc(c(CCC(=O)O)c1C)Cc1nc(c(C)c1CCC(=O)O)Cc1nc(c(C)c1C=C)C2 |
| InChI | InChI=1S/C34H40N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,35-38H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42) |
| InChIKey | UHSGPDMIQQYNAX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoporphyrinogen (CHEBI:15435) has role Escherichia coli metabolite (CHEBI:76971) |
| protoporphyrinogen (CHEBI:15435) has role mouse metabolite (CHEBI:75771) |
| protoporphyrinogen (CHEBI:15435) is a porphyrinogens (CHEBI:36321) |
| protoporphyrinogen (CHEBI:15435) is conjugate acid of protoporphyrinogen(2−) (CHEBI:57307) |
| Incoming Relation(s) |
| protoporphyrinogen(2−) (CHEBI:57307) is conjugate base of protoporphyrinogen (CHEBI:15435) |
| Synonyms | Source |
|---|---|
| 7,12-diethenyl-3,8,13,17-tetramethyl-5,10,15,20,22,24-hexahydroporphyrin-2,18-dipropanoic acid | JCBN |
| Protoporphyrinogen IX | KEGG COMPOUND |