EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O3 |
| Net Charge | 0 |
| Average Mass | 268.317 |
| Monoisotopic Mass | 268.15354 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C12H20N4O3/c1-7(2)3-10(12(18)19)16-11(17)9(13)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | MMFKFJORZBJVNF-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Leu (CHEBI:5729) has role metabolite (CHEBI:25212) |
| His-Leu (CHEBI:5729) is a dipeptide (CHEBI:46761) |
| His-Leu (CHEBI:5729) is tautomer of His-Leu zwitterion (CHEBI:147392) |
| Incoming Relation(s) |
| His-Leu zwitterion (CHEBI:147392) is tautomer of His-Leu (CHEBI:5729) |
| IUPAC Name |
|---|
| L-histidyl-L-leucine |
| Synonyms | Source |
|---|---|
| His-Leu | KEGG COMPOUND |
| HL | ChEBI |
| L-His-L-Leu | ChEBI |
| N-L-Histidyl-L-leucine | KEGG COMPOUND |
| Histidylleucine | KEGG COMPOUND |
| H-L | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05010 | KEGG COMPOUND |
| HMDB0028889 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90769 | Reaxys |
| CAS:7763-65-7 | KEGG COMPOUND |
| CAS:7763-65-7 | ChemIDplus |