EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O3 |
| Net Charge | 0 |
| Average Mass | 268.317 |
| Monoisotopic Mass | 268.15354 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]([NH3+])Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C12H20N4O3/c1-7(2)3-10(12(18)19)16-11(17)9(13)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | MMFKFJORZBJVNF-UWVGGRQHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Leu zwitterion (CHEBI:147392) is a dipeptide zwitterion (CHEBI:90799) |
| His-Leu zwitterion (CHEBI:147392) is tautomer of His-Leu (CHEBI:5729) |
| Incoming Relation(s) |
| His-Leu (CHEBI:5729) is tautomer of His-Leu zwitterion (CHEBI:147392) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-azaniumyl-3-(1H-imidazol-4-yl)propanoyl]amino}-4-methylpentanoate |
| Synonyms | Source |
|---|---|
| histidylleucine zwitterion | ChEBI |
| H-L zwitterion | ChEBI |
| L-His-L-Leu zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-histidyl-L-leucine | UniProt |