EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | C[NH2+][C@@H](Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | CZCIKBSVHDNIDH-NSHDSACASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) is a N-methyl-L-α-amino acid zwitterion (CHEBI:86139) |
| Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) is tautomer of Nα-methyl-L-tryptophan (CHEBI:15334) |
| Incoming Relation(s) |
| Nα,Nα-dimethyl-L-tryptophan zwitterion (CHEBI:231710) has functional parent Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) |
| Nα-methyl-L-tryptophan (CHEBI:15334) is tautomer of Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-(methylazaniumyl)propanoate |
| UniProt Name | Source |
|---|---|
| Nα-methyl-L-tryptophan | UniProt |