EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | CN[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | CZCIKBSVHDNIDH-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-methyl-L-tryptophan (CHEBI:15334) has role Escherichia coli metabolite (CHEBI:76971) |
| Nα-methyl-L-tryptophan (CHEBI:15334) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| Nα-methyl-L-tryptophan (CHEBI:15334) is a L-tryptophan derivative (CHEBI:47994) |
| Nα-methyl-L-tryptophan (CHEBI:15334) is tautomer of Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) |
| Incoming Relation(s) |
| Nα-methyl-L-tryptophan zwitterion (CHEBI:57283) is tautomer of Nα-methyl-L-tryptophan (CHEBI:15334) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoic acid |
| Synonyms | Source |
|---|---|
| Abrine | KEGG COMPOUND |
| L-Abrine | KEGG COMPOUND |
| N-methyl-L-tryptophan | ChemIDplus |