EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3O4 |
| Net Charge | -1 |
| Average Mass | 139.086 |
| Monoisotopic Mass | 139.00368 |
| SMILES | [H]C(C(=O)[O-])=C1C=CC(=O)O1 |
| InChI | InChI=1S/C6H4O4/c7-5(8)3-4-1-2-6(9)10-4/h1-3H,(H,7,8)/p-1 |
| InChIKey | AYFXPGXAZMFWNH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxylatomethylenebut-2-en-4-olide (CHEBI:57263) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-carboxylatomethylenebut-2-en-4-olide (CHEBI:57263) is conjugate base of 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) |
| Incoming Relation(s) |
| 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) is conjugate acid of 4-carboxylatomethylenebut-2-en-4-olide (CHEBI:57263) |
| IUPAC Name |
|---|
| (5-oxofuran-2(5H)-ylidene)acetate |
| UniProt Name | Source |
|---|---|
| 2-(5-oxo-2,5-dihydrofuran-2-ylidene)acetate | UniProt |