EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O4 |
| Net Charge | 0 |
| Average Mass | 140.094 |
| Monoisotopic Mass | 140.01096 |
| SMILES | [H]C(C(=O)O)=C1C=CC(=O)O1 |
| InChI | InChI=1S/C6H4O4/c7-5(8)3-4-1-2-6(9)10-4/h1-3H,(H,7,8) |
| InChIKey | AYFXPGXAZMFWNH-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) is a butenolide (CHEBI:50523) |
| 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) is conjugate acid of 4-carboxylatomethylenebut-2-en-4-olide (CHEBI:57263) |
| Incoming Relation(s) |
| cis-4-carboxymethylenebut-2-en-4-olide (CHEBI:18371) is a 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) |
| trans-4-carboxymethylenebut-2-en-4-olide (CHEBI:38107) is a 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) |
| 4-carboxylatomethylenebut-2-en-4-olide (CHEBI:57263) is conjugate base of 4-carboxymethylenebut-2-en-4-olide (CHEBI:11972) |
| IUPAC Name |
|---|
| (5-oxofuran-2(5H)-ylidene)acetic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3111 | Beilstein |