EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H64O17 |
| Net Charge | 0 |
| Average Mass | 901.012 |
| Monoisotopic Mass | 900.41435 |
| SMILES | CCC(O)/C=C/C=C\C=C\C(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(=O)/C=C/C=C/C[C@H](O)/C(C)=C/C=C/CC[C@@H](C)CC)[C@@H](O)[C@@]3(OCc4cc(O)cc(O)c43)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C47H64O17/c1-5-28(3)17-11-9-12-18-29(4)33(51)20-14-10-16-22-38(54)62-44-43(35(25-48)64-47(45(44)58)39-30(26-60-47)23-32(50)24-34(39)52)63-46-42(57)41(56)40(55)36(61-46)27-59-37(53)21-15-8-7-13-19-31(49)6-2/h7-10,12-16,18-19,21-24,28,31,33,35-36,40-46,48-52,55-58H,5-6,11,17,20,25-27H2,1-4H3/b8-7-,12-9+,14-10+,19-13+,21-15+,22-16+,29-18+/t28-,31?,33-,35+,36+,40-,41-,42+,43+,44-,45+,46-,47-/m0/s1 |
| InChIKey | UJLFRJFJTPPIOK-RZGJRGQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papulacandin B (CHEBI:569624) has functional parent α-lactose (CHEBI:36219) |
| papulacandin B (CHEBI:569624) has role antifungal agent (CHEBI:35718) |
| papulacandin B (CHEBI:569624) has role metabolite (CHEBI:25212) |
| papulacandin B (CHEBI:569624) is a disaccharide derivative (CHEBI:63353) |
| papulacandin B (CHEBI:569624) is a organic heterotricyclic compound (CHEBI:26979) |
| papulacandin B (CHEBI:569624) is a papulacandin (CHEBI:72596) |
| IUPAC Name |
|---|
| (1S,3'R,4'R,5'R,6'R)-3',5,7-trihydroxy-5'-({6-O-[(2E,4Z,6E)-8-hydroxydeca-2,4,6-trienoyl]-β-D-galactopyranosyl}oxy)-6'-(hydroxymethyl)-3',4',5',6'-tetrahydro-3H-spiro[2-benzofuran-1,2'-pyran]-4'-yl (2E,4E,7S,8E,10E,14S)-7-hydroxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate |
| Synonym | Source |
|---|---|
| papulacandin-B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Papulacandin_B | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7682569 | Reaxys |
| CAS:61032-80-2 | ChemIDplus |
| Citations |
|---|