EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N2O9 |
| Net Charge | 0 |
| Average Mass | 574.671 |
| Monoisotopic Mass | 574.28903 |
| SMILES | CO[C@H]1[C@@H](OC)C[C@H](C)[C@@H](OC)C2=CC(=O)C=C(NC(=O)/C(C)=C/C=C\[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@@H]1C)C2=O |
| InChI | InChI=1S/C30H42N2O9/c1-16-10-9-11-23(37-5)28(41-30(31)36)18(3)12-17(2)27(40-8)24(38-6)13-19(4)26(39-7)21-14-20(33)15-22(25(21)34)32-29(16)35/h9-12,14-15,17,19,23-24,26-28H,13H2,1-8H3,(H2,31,36)(H,32,35)/b11-9-,16-10+,18-12+/t17-,19-,23-,24-,26+,27+,28-/m0/s1 |
| InChIKey | MCAHMSDENAOJFZ-BVXDHVRPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| herbimycin (CHEBI:5674) has role antimicrobial agent (CHEBI:33281) |
| herbimycin (CHEBI:5674) has role apoptosis inducer (CHEBI:68495) |
| herbimycin (CHEBI:5674) has role herbicide (CHEBI:24527) |
| herbimycin (CHEBI:5674) has role Hsp90 inhibitor (CHEBI:63962) |
| herbimycin (CHEBI:5674) has role tyrosine kinase inhibitor (CHEBI:38637) |
| herbimycin (CHEBI:5674) is a 1,4-benzoquinones (CHEBI:132124) |
| herbimycin (CHEBI:5674) is a lactam (CHEBI:24995) |
| herbimycin (CHEBI:5674) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16S,17R)-8,13,14,17-tetramethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
| Synonyms | Source |
|---|---|
| Herbimycin A | KEGG COMPOUND |
| Antibiotic Tan 420F | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11225 | KEGG COMPOUND |
| Herbimycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4834067 | Reaxys |
| CAS:70563-58-5 | KEGG COMPOUND |
| CAS:70563-58-5 | ChemIDplus |
| Citations |
|---|