EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N2O9 |
| Net Charge | 0 |
| Average Mass | 574.671 |
| Monoisotopic Mass | 574.28903 |
| SMILES | CO[C@H]1[C@@H](OC)C[C@H](C)[C@@H](OC)C2=CC(=O)C=C(NC(=O)/C(C)=C/C=C\[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@@H]1C)C2=O |
| InChI | InChI=1S/C30H42N2O9/c1-16-10-9-11-23(37-5)28(41-30(31)36)18(3)12-17(2)27(40-8)24(38-6)13-19(4)26(39-7)21-14-20(33)15-22(25(21)34)32-29(16)35/h9-12,14-15,17,19,23-24,26-28H,13H2,1-8H3,(H2,31,36)(H,32,35)/b11-9-,16-10+,18-12+/t17-,19-,23-,24-,26+,27+,28-/m0/s1 |
| InChIKey | MCAHMSDENAOJFZ-BVXDHVRPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| herbimycin (CHEBI:5674) has role antimicrobial agent (CHEBI:33281) |
| herbimycin (CHEBI:5674) has role apoptosis inducer (CHEBI:68495) |
| herbimycin (CHEBI:5674) has role herbicide (CHEBI:24527) |
| herbimycin (CHEBI:5674) has role Hsp90 inhibitor (CHEBI:63962) |
| herbimycin (CHEBI:5674) has role tyrosine kinase inhibitor (CHEBI:38637) |
| herbimycin (CHEBI:5674) is a 1,4-benzoquinones (CHEBI:132124) |
| herbimycin (CHEBI:5674) is a lactam (CHEBI:24995) |
| herbimycin (CHEBI:5674) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16S,17R)-8,13,14,17-tetramethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
| Synonyms | Source |
|---|---|
| Antibiotic Tan 420F | ChemIDplus |
| Herbimycin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11225 | KEGG COMPOUND |
| Herbimycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4834067 | Reaxys |
| CAS:70563-58-5 | ChemIDplus |
| CAS:70563-58-5 | KEGG COMPOUND |
| Citations |
|---|