EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5601 - (+)-haematoxylin
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | [H][C@]12c3cc(O)c(O)cc3C[C@@]1(O)COc1c2ccc(O)c1O |
| InChI | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2/t13-,16+/m0/s1 |
| InChIKey | WZUVPPKBWHMQCE-XJKSGUPXSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-haematoxylin (CHEBI:5601) is a haematoxylin (CHEBI:51686) |
| (+)-haematoxylin (CHEBI:5601) is enantiomer of (−)-haematoxylin (CHEBI:51684) |
| Incoming Relation(s) |
| (−)-haematoxylin (CHEBI:51684) is enantiomer of (+)-haematoxylin (CHEBI:5601) |
| IUPAC Name |
|---|
| (6aS,11bR)-7,11b-dihydroindeno[2,1-c]chromene-3,4,6a,9,10(6H)-pentol |
| Synonyms | Source |
|---|---|
| Haematoxylin | KEGG COMPOUND |
| (+)-hematoxylin | ChemIDplus |
| (6aS,11bR)-7,11b-dihydrobenz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol | ChemIDplus |
| cis-(+)-7,11b-dihydrobenz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol | ChemIDplus |
| hydroxybrasilin | ChemIDplus |
| hydroxybrazilin | ChemIDplus |