EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51686 - haematoxylin
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | Oc1cc2c(cc1O)C1c3ccc(O)c(O)c3OCC1(O)C2 |
| InChI | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2 |
| InChIKey | WZUVPPKBWHMQCE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Haematoxylum campechianum (ncbitaxon:321551) | - | PubMed (12751322) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haematoxylin (CHEBI:51686) has role histological dye (CHEBI:77178) |
| haematoxylin (CHEBI:51686) has role plant metabolite (CHEBI:76924) |
| haematoxylin (CHEBI:51686) is a organic heterotetracyclic compound (CHEBI:38163) |
| haematoxylin (CHEBI:51686) is a oxacycle (CHEBI:38104) |
| haematoxylin (CHEBI:51686) is a polyphenol (CHEBI:26195) |
| haematoxylin (CHEBI:51686) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| (+)-haematoxylin (CHEBI:5601) is a haematoxylin (CHEBI:51686) |
| (−)-haematoxylin (CHEBI:51684) is a haematoxylin (CHEBI:51686) |
| IUPAC Name |
|---|
| 7,11b-dihydroindeno[2,1-c]chromene-3,4,6a,9,10(6H)-pentol |
| Synonyms | Source |
|---|---|
| hematoxylin | ChemIDplus |
| Hämatoxylin | ChEBI |
| hematoxilina | ChEBI |
| hématoxyline | ChEBI |
| 7,11b-dihydrobenz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol | ChemIDplus |
| Natural black 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91399 | Reaxys |
| CAS:17647-60-8 | ChemIDplus |
| Citations |
|---|