EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22N4 |
| Net Charge | 0 |
| Average Mass | 198.314 |
| Monoisotopic Mass | 198.18445 |
| SMILES | N=C(N)NCCN1CCCCCCC1 |
| InChI | InChI=1S/C10H22N4/c11-10(12)13-6-9-14-7-4-2-1-3-5-8-14/h1-9H2,(H4,11,12,13) |
| InChIKey | ACGDKVXYNVEAGU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanethidine (CHEBI:5557) has functional parent guanidine (CHEBI:42820) |
| guanethidine (CHEBI:5557) has parent hydride azocane (CHEBI:38792) |
| guanethidine (CHEBI:5557) has role adrenergic antagonist (CHEBI:37887) |
| guanethidine (CHEBI:5557) has role antihypertensive agent (CHEBI:35674) |
| guanethidine (CHEBI:5557) has role sympatholytic agent (CHEBI:66991) |
| guanethidine (CHEBI:5557) is a azocanes (CHEBI:38791) |
| guanethidine (CHEBI:5557) is a guanidines (CHEBI:24436) |
| Incoming Relation(s) |
| guanethidine monosulfate (CHEBI:51016) has part guanethidine (CHEBI:5557) |
| IUPAC Name |
|---|
| 1-(2-azocan-1-ylethyl)guanidine |
| INNs | Source |
|---|---|
| guanethidine | ChEBI |
| guanéthidine | ChEBI |
| guanethidinum | ChEBI |
| guanetidina | ChEBI |
| Synonyms | Source |
|---|---|
| 2-(1'-Azacyclooctyl)ethylguanidine | ChemIDplus |
| 2-(1-N,N-Heptamethyleneimino)ethylguanidine | ChemIDplus |
| (2-(Octahydro-1-azocinyl)ethyl)guanidine | ChemIDplus |
| Azocine, 1-(2-guanidinoethyl)octahydro- | ChemIDplus |
| N-(2-Perhydroazocin-1-ylethyl)guanidine | ChemIDplus |
| Guanethidine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1342 | DrugCentral |
| C07036 | KEGG COMPOUND |
| D08030 | KEGG DRUG |
| DB01170 | DrugBank |
| Guanethidine | Wikipedia |
| HMDB0015301 | HMDB |
| LSM-6719 | LINCS |
| US2928829 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1343950 | Reaxys |
| CAS:55-65-2 | ChemIDplus |
| Citations |
|---|