EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C10H22N4.O4S |
| Net Charge | 0 |
| Average Mass | 296.393 |
| Monoisotopic Mass | 296.15183 |
| SMILES | N=C(N)NCCN1CCCCCCC1.O=S(=O)([O-])[O-].[H+].[H+] |
| InChI | InChI=1S/C10H22N4.H2O4S/c11-10(12)13-6-9-14-7-4-2-1-3-5-8-14;1-5(2,3)4/h1-9H2,(H4,11,12,13);(H2,1,2,3,4) |
| InChIKey | YUFWAVFNITUSHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanethidine monosulfate (CHEBI:51016) has part guanethidine (CHEBI:5557) |
| guanethidine monosulfate (CHEBI:51016) has role antihypertensive agent (CHEBI:35674) |
| guanethidine monosulfate (CHEBI:51016) is a organic sulfate salt (CHEBI:51337) |
| Incoming Relation(s) |
| guanethidine sulfate (CHEBI:51017) has part guanethidine monosulfate (CHEBI:51016) |
| IUPAC Name |
|---|
| 1-(2-azocan-1-ylethyl)guanidine sulfate |
| Synonyms | Source |
|---|---|
| (2-(Hexahydro-1(2H)-azocinyl)ethyl) guanidine hydrogen sulfate | ChemIDplus |
| (2-(Hexahydro-1(2H)-azocinyl)ethyl)guanidine sulfate (1:1) | ChemIDplus |
| 2-(Octahydro-1-azocinyl)ethyl guanidine sulphate | ChemIDplus |
| Citations |
|---|