EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17O3 |
| Net Charge | -1 |
| Average Mass | 173.232 |
| Monoisotopic Mass | 173.11832 |
| SMILES | CCCCCCC[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C9H18O3/c1-2-3-4-5-6-7-8(10)9(11)12/h8,10H,2-7H2,1H3,(H,11,12)/p-1/t8-/m1/s1 |
| InChIKey | BTJFTHOOADNOOS-MRVPVSSYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxynonanoate (CHEBI:55540) has functional parent nonanoate (CHEBI:32361) |
| (R)-2-hydroxynonanoate (CHEBI:55540) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| (R)-2-hydroxynonanoate (CHEBI:55540) is conjugate base of (R)-2-hydroxynonanoic acid (CHEBI:55538) |
| Incoming Relation(s) |
| (R)-2-hydroxynonanoic acid (CHEBI:55538) is conjugate acid of (R)-2-hydroxynonanoate (CHEBI:55540) |
| IUPAC Name |
|---|
| (2R)-2-hydroxynonanoate |