EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17O2 |
| Net Charge | -1 |
| Average Mass | 157.233 |
| Monoisotopic Mass | 157.12340 |
| SMILES | CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/p-1 |
| InChIKey | FBUKVWPVBMHYJY-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonanoate (CHEBI:32361) has role plant metabolite (CHEBI:76924) |
| nonanoate (CHEBI:32361) is a medium-chain fatty acid anion (CHEBI:59558) |
| nonanoate (CHEBI:32361) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| nonanoate (CHEBI:32361) is conjugate base of nonanoic acid (CHEBI:29019) |
| Incoming Relation(s) |
| (R)-2-hydroxynonanoate (CHEBI:55540) has functional parent nonanoate (CHEBI:32361) |
| O-nonanoyl-L-serine residue (CHEBI:177291) has functional parent nonanoate (CHEBI:32361) |
| 2-oxononanoate (CHEBI:55525) has functional parent nonanoate (CHEBI:32361) |
| 7,8-diaminononanoate (CHEBI:17830) has functional parent nonanoate (CHEBI:32361) |
| 8-amino-7-oxononanoate (CHEBI:12266) has functional parent nonanoate (CHEBI:32361) |
| nonanoic acid (CHEBI:29019) is conjugate acid of nonanoate (CHEBI:32361) |
| IUPAC Name |
|---|
| nonanoate |
| Synonyms | Source |
|---|---|
| 1-nonanoate | ChEBI |
| 1-octanecarboxylate | ChEBI |
| CH3‒[CH2]7‒COO− | IUPAC |
| n-nonanoate | ChEBI |
| nonoate | ChEBI |
| nonylate | ChEBI |
| UniProt Name | Source |
|---|---|
| nonanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329987 | Gmelin |
| Beilstein:3904165 | Beilstein |