EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CC[C@H](C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H12O3/c1-3-4(2)5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | RILPIWOPNGRASR-CRCLSJGQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) has functional parent valeric acid (CHEBI:17418) |
| (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) is a (2R)-2-hydroxy monocarboxylic acid (CHEBI:17893) |
| (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) is a 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) |
| (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) is conjugate acid of (2R,3S)-2-hydroxy-3-methylpentanoate (CHEBI:55537) |
| Incoming Relation(s) |
| (2R,3S)-2-hydroxy-3-methylpentanoate (CHEBI:55537) is conjugate base of (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) |
| IUPAC Name |
|---|
| (2R,3S)-2-hydroxy-3-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| (2R,3S)-2-hydroxy-3-methylvaleric acid | ChEBI |
| (2R,3S)-HMVA | ChEBI |
| HMVA | ChEBI |
| (2R,3S)-isoleucic acid | ChEBI |
| (R,S)-isoleucic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1721800 | Beilstein |
| Citations |
|---|