EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CCC(C)C(O)C(=O)O |
| InChI | InChI=1S/C6H12O3/c1-3-4(2)5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9) |
| InChIKey | RILPIWOPNGRASR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) is a branched-chain fatty acid (CHEBI:35819) |
| 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) is a short-chain fatty acid (CHEBI:26666) |
| 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) is conjugate acid of 2-hydroxy-3-methylpentanoate (CHEBI:133085) |
| Incoming Relation(s) |
| (2R,3R)-2-hydroxy-3-methylpentanoic acid (CHEBI:89228) is a 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) |
| (2R,3S)-2-hydroxy-3-methylpentanoic acid (CHEBI:55536) is a 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) |
| 2-hydroxy-3-methylpentanoate (CHEBI:133085) is conjugate base of 2-hydroxy-3-methylpentanoic acid (CHEBI:133083) |
| IUPAC Name |
|---|
| 2-hydroxy-3-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-3-methylvaleric acid | ChemIDplus |
| α-hydroxy-β-methylpentanoic acid | ChEBI |
| isoleucic acid | ChEBI |
| α-hydroxy-β-methylvaleric acid | ChEBI |