EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N5O5S2 |
| Net Charge | -1 |
| Average Mass | 382.403 |
| Monoisotopic Mass | 382.02853 |
| SMILES | [H][C@]12SCC=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C13H13N5O5S2/c1-23-17-7(5-4-25-13(14)15-5)9(19)16-8-10(20)18-6(12(21)22)2-3-24-11(8)18/h2,4,8,11H,3H2,1H3,(H2,14,15)(H,16,19)(H,21,22)/p-1/b17-7-/t8-,11-/m1/s1 |
| InChIKey | NNULBSISHYWZJU-LLKWHZGFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftizoxime(1−) (CHEBI:55498) is a monocarboxylic acid anion (CHEBI:35757) |
| ceftizoxime(1−) (CHEBI:55498) is conjugate base of ceftizoxime (CHEBI:553473) |
| Incoming Relation(s) |
| ceftizoxime sodium (CHEBI:3512) has part ceftizoxime(1−) (CHEBI:55498) |
| ceftizoxime (CHEBI:553473) is conjugate acid of ceftizoxime(1−) (CHEBI:55498) |
| IUPAC Name |
|---|
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2,3-didehydropenam-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8449783 | Beilstein |