EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N5O5S2 |
| Net Charge | 0 |
| Average Mass | 383.411 |
| Monoisotopic Mass | 383.03581 |
| SMILES | [H][C@]12SCC=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C13H13N5O5S2/c1-23-17-7(5-4-25-13(14)15-5)9(19)16-8-10(20)18-6(12(21)22)2-3-24-11(8)18/h2,4,8,11H,3H2,1H3,(H2,14,15)(H,16,19)(H,21,22)/b17-7-/t8-,11-/m1/s1 |
| InChIKey | NNULBSISHYWZJU-LLKWHZGFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftizoxime (CHEBI:553473) has role antibacterial drug (CHEBI:36047) |
| ceftizoxime (CHEBI:553473) is a cephalosporin (CHEBI:23066) |
| ceftizoxime (CHEBI:553473) is conjugate acid of ceftizoxime(1−) (CHEBI:55498) |
| Incoming Relation(s) |
| ceftizoxime(1−) (CHEBI:55498) is conjugate base of ceftizoxime (CHEBI:553473) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2,3-didehydropenam-2-carboxylic acid |
| INNs | Source |
|---|---|
| ceftizoxima | ChemIDplus |
| ceftizoxime | ChemIDplus |
| ceftizoximum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 7-[2-(2-Amino-thiazol-4-yl)-2-methoxyimino-acetylamino]-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ChEMBL |
| CEFIZOX | ChEMBL |
| Ceftizoxime | KEGG COMPOUND |
| CEFTIZOXIME | ChEMBL |
| syn-7-(2-(2-Amino-4-thiazolyl)-2-methoxyiminoacetamido)-3-cephem-4-carboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 563 | DrugCentral |
| C06890 | KEGG COMPOUND |
| Ceftizoxime | Wikipedia |
| D07658 | KEGG DRUG |
| DB01332 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5777502 | Reaxys |
| CAS:68401-81-0 | KEGG COMPOUND |
| CAS:68401-81-0 | ChemIDplus |
| Citations |
|---|