EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N5O8PS2 |
| Net Charge | 0 |
| Average Mass | 535.541 |
| Monoisotopic Mass | 535.09604 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)CCCCC2CCSS2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26N5O8PS2/c19-16-13-17(21-8-20-16)23(9-22-13)18-15(26)14(25)11(30-18)7-29-32(27,28)31-12(24)4-2-1-3-10-5-6-33-34-10/h8-11,14-15,18,25-26H,1-7H2,(H,27,28)(H2,19,20,21)/t10?,11-,14-,15-,18-/m1/s1 |
| InChIKey | QWEGOCJRZOKSOE-NLJBGGCZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoyl-AMP (CHEBI:55451) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| lipoyl-AMP (CHEBI:55451) has functional parent lipoic acid (CHEBI:16494) |
| lipoyl-AMP (CHEBI:55451) has functional parent octanoic acid (CHEBI:28837) |
| lipoyl-AMP (CHEBI:55451) has role Escherichia coli metabolite (CHEBI:76971) |
| lipoyl-AMP (CHEBI:55451) has role mouse metabolite (CHEBI:75771) |
| lipoyl-AMP (CHEBI:55451) is a acyclic mixed acid anhydride (CHEBI:37787) |
| lipoyl-AMP (CHEBI:55451) is a dithiolanes (CHEBI:39192) |
| lipoyl-AMP (CHEBI:55451) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| lipoyl-AMP (CHEBI:55451) is conjugate acid of lipoyl-AMP(1−) (CHEBI:58923) |
| Incoming Relation(s) |
| (R)-lipoyl-AMP (CHEBI:83864) is a lipoyl-AMP (CHEBI:55451) |
| lipoyl-AMP(1−) (CHEBI:58923) is conjugate base of lipoyl-AMP (CHEBI:55451) |
| IUPAC Name |
|---|
| 5'-O-[{[5-(1,2-dithiolan-3-yl)pentanoyl]oxy}(hydroxy)phosphoryl]adenosine |
| Synonym | Source |
|---|---|
| Lipoyl-AMP | ChEBI |