EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O3S |
| Net Charge | 0 |
| Average Mass | 323.418 |
| Monoisotopic Mass | 323.13036 |
| SMILES | [H][C@@]1([C@H](N)C(=O)NCc2ccccc2)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C15H21N3O3S/c1-15(2)11(14(20)21)18-13(22-15)10(16)12(19)17-8-9-6-4-3-5-7-9/h3-7,10-11,13,18H,8,16H2,1-2H3,(H,17,19)(H,20,21)/t10-,11+,13-/m1/s1 |
| InChIKey | UUFDDZSZUMPADR-NTZNESFSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminopenicilloyl-benzylamine (CHEBI:55442) has part 6-aminopenicilloyl group (CHEBI:55441) |
| 6-aminopenicilloyl-benzylamine (CHEBI:55442) is a monocarboxylic acid amide (CHEBI:29347) |
| 6-aminopenicilloyl-benzylamine (CHEBI:55442) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| Synonyms | Source |
|---|---|
| (2R,4S)-2-[(1R)-1-amino-2-(benzylamino)-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid | ChEBI |
| 6-APA-BA | ChEBI |
| Citations |
|---|