EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30FeN4O4 |
| Net Charge | -1 |
| Average Mass | 614.483 |
| Monoisotopic Mass | 614.16219 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Fe-]35[n]6c(c(C)c(CCC(=O)[O-])c6=CC6=[N+]3C(=C4)C(C)=C6CCC(=O)[O-])=CC1=[N+]25 |
| InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+3/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | GGIDWJQWCUJYRY-RGGAHWMASA-J |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferriheme b(1−) (CHEBI:55376) is a heme b (CHEBI:26355) |
| ferriheme b(1−) (CHEBI:55376) is conjugate base of ferriheme b (CHEBI:36144) |
| Incoming Relation(s) |
| ferriheme b (CHEBI:36144) is conjugate acid of ferriheme b(1−) (CHEBI:55376) |
| IUPAC Name |
|---|
| [3,3'-(7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-diyl-κ4N21,N22,N23,N24)dipropanoato(4-)]iron(1−) |
| UniProt Name | Source |
|---|---|
| Fe(III)-heme b | UniProt |