EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36144 - ferriheme b
| Formula | C34H32FeN4O4 |
| Net Charge | +1 |
| Average Mass | 616.499 |
| Monoisotopic Mass | 616.17674 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Fe+]35[N]2=C1C=c1c(C)c(CCC(=O)O)c([n]13)=CC1=[N]5C(=C4)C(C)=C1CCC(=O)O |
| InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+3/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | GGIDWJQWCUJYRY-RGGAHWMASA-L |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferriheme b (CHEBI:36144) is a ferriheme (CHEBI:38574) |
| ferriheme b (CHEBI:36144) is a heme b (CHEBI:26355) |
| ferriheme b (CHEBI:36144) is conjugate acid of ferriheme b(1−) (CHEBI:55376) |
| Incoming Relation(s) |
| ferricytochrome b (CHEBI:5022) has part ferriheme b (CHEBI:36144) |
| ferriheme b(1−) (CHEBI:55376) is conjugate base of ferriheme b (CHEBI:36144) |
| IUPAC Names |
|---|
| (protoporphyrinato)iron(III) |
| (protoporphyrinato)iron(1+) |
| Synonyms | Source |
|---|---|
| [Fe(ppIX)]+ | IUPAC |
| ferriheme | ChEBI |
| ferriprotoheme | ChEBI |
| protoferriheme | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:738065 | Gmelin |
| Beilstein:4932321 | Beilstein |