EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7Cl2N3O.HCl |
| Net Charge | 0 |
| Average Mass | 292.553 |
| Monoisotopic Mass | 290.97329 |
| SMILES | Cl.O=C1CN2Cc3c(ccc(Cl)c3Cl)N=C2N1 |
| InChI | InChI=1S/C10H7Cl2N3O.ClH/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7;/h1-2H,3-4H2,(H,13,14,16);1H |
| InChIKey | TVWRQCIPWUCNMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anagrelide hydrochloride (CHEBI:55345) has part anagrelide (CHEBI:142290) |
| anagrelide hydrochloride (CHEBI:55345) has role antifibrinolytic drug (CHEBI:48675) |
| anagrelide hydrochloride (CHEBI:55345) has role platelet aggregation inhibitor (CHEBI:50427) |
| anagrelide hydrochloride (CHEBI:55345) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 6,7-dichloro-1,5-dihydroimidazo[2,1-b]quinazolin-2(3H)-one hydrochloride |
| INNs | Source |
|---|---|
| anagrelida | ChEBI |
| anagrelide | ChEBI |
| anagrelidum | ChEBI |
| Synonyms | Source |
|---|---|
| 6,7-Dichloro-1,5-dihydroimidazo(2,1-b)-quinazolin-2(3H)-one monohydrochloride | ChemIDplus |
| Anagrelide HCL | DrugBank |
| Anagrelid hydrochlorid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4614131 | Beilstein |
| CAS:58579-51-4 | KEGG DRUG |
| CAS:58579-51-4 | ChemIDplus |