EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:142290 - anagrelide
| Formula | C10H7Cl2N3O |
| Net Charge | 0 |
| Average Mass | 256.092 |
| Monoisotopic Mass | 254.99662 |
| SMILES | O=C1CN2Cc3c(ccc(Cl)c3Cl)N=C2N1 |
| InChI | InChI=1S/C10H7Cl2N3O/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7/h1-2H,3-4H2,(H,13,14,16) |
| InChIKey | OTBXOEAOVRKTNQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticoagulant An agent that prevents blood clotting. antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anagrelide (CHEBI:142290) has role anticoagulant (CHEBI:50249) |
| anagrelide (CHEBI:142290) has role antifibrinolytic drug (CHEBI:48675) |
| anagrelide (CHEBI:142290) has role cardiovascular drug (CHEBI:35554) |
| anagrelide (CHEBI:142290) has role platelet aggregation inhibitor (CHEBI:50427) |
| anagrelide (CHEBI:142290) is a imidazoquinazoline (CHEBI:47975) |
| Incoming Relation(s) |
| anagrelide hydrochloride (CHEBI:55345) has part anagrelide (CHEBI:142290) |
| IUPAC Name |
|---|
| 6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one |
| INNs | Source |
|---|---|
| anagrelide | ChemIDplus |
| anagrelida | ChemIDplus |
| anagrelidum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07455 | KEGG DRUG |
| DB00261 | DrugBank |
| Anagrelide | Wikipedia |
| LSM-3380 | LINCS |
| 209 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:619582 | Beilstein |
| CAS:68475-42-3 | KEGG DRUG |
| CAS:68475-42-3 | DrugBank |
| CAS:68475-42-3 | ChemIDplus |