EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H50N4O2 |
| Net Charge | +2 |
| Average Mass | 666.910 |
| Monoisotopic Mass | 666.39228 |
| SMILES | [H][C@]12C[C@]3([H])/C4=C/N5c6ccccc6[C@]67CC[N@@+]8(CC=C)C/C(=C/CO)[C@]([H])(C[C@@]68[H])/C(=C/N6c8ccccc8[C@@]1(CC[N@@+]2(CC=C)C/C3=C/CO)[C@]46[H])[C@]57[H] |
| InChI | InChI=1S/C44H50N4O2/c1-3-17-47-19-15-43-35-9-5-7-11-37(35)45-26-34-32-24-40-44(16-20-48(40,18-4-2)28-30(32)14-22-50)36-10-6-8-12-38(36)46(42(34)44)25-33(41(43)45)31(23-39(43)47)29(27-47)13-21-49/h3-14,25-26,31-32,39-42,49-50H,1-2,15-24,27-28H2/q+2/b29-13-,30-14-,33-25-,34-26-/t31-,32-,39-,40-,41-,42-,43+,44+,47-,48-/m0/s1 |
| InChIKey | MUQUYTSLDVKIOF-CHJKCJHBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alcuronium (CHEBI:55313) has role muscle relaxant (CHEBI:51371) |
| alcuronium (CHEBI:55313) is a indole alkaloid (CHEBI:38958) |
| Incoming Relation(s) |
| alcuronium bromide (CHEBI:488385) has part alcuronium (CHEBI:55313) |
| alcuronium chloride (CHEBI:31185) has part alcuronium (CHEBI:55313) |
| IUPAC Name |
|---|
| (1R,3aR,9Z,10S,11aS,12R,14aR,19aS,20Z,20bS,21S,22aS,23E,26E)-23,26-bis(2-hydroxyethylidene)-1,12-di(prop-2-en-1-yl)-1,2,3,10,11,11a,12,13,14,21,22,22a-dodecahydro-19aH,20bH-1,21:10,12-diethanodipyrrolo[3,2-f:3,2-f'][1,5]diazocino[3,2,1-jk:7,6,5-j'k']dicarbazole-1,12-diium |
| Synonyms | Source |
|---|---|
| 4,4'-Didemethyl-4,4'-di-2-propenyl-toxiferine I (9CI) | ChemIDplus |
| Alcuronium | ChEMBL |
| Alcuronium cation | ChEMBL |
| Alcuronium ion | ChEMBL |
| Alcuronum | ChemIDplus |
| Alloferine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4101239 | Reaxys |
| CAS:23214-96-2 | ChemIDplus |
| Citations |
|---|