EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O13 |
| Net Charge | 0 |
| Average Mass | 480.378 |
| Monoisotopic Mass | 480.09039 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O13/c22-5-11-13(27)15(29)17(31)21(32-11)34-19-10(26)4-9(25)12-14(28)16(30)18(33-20(12)19)6-1-2-7(23)8(24)3-6/h1-4,11,13,15,17,21-27,29-31H,5H2/t11-,13-,15+,17-,21+/m1/s1 |
| InChIKey | SJRXVLUZMMDCNG-KKPQBLLMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fioria vitifolia (ncbitaxon:183231) | - | PubMed (23738444) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gossypin (CHEBI:5525) has functional parent gossypetin (CHEBI:16400) |
| gossypin (CHEBI:5525) has role neuroprotective agent (CHEBI:63726) |
| gossypin (CHEBI:5525) has role plant metabolite (CHEBI:76924) |
| gossypin (CHEBI:5525) is a 7-hydroxyflavonol (CHEBI:52267) |
| gossypin (CHEBI:5525) is a glycosyloxyflavone (CHEBI:50018) |
| gossypin (CHEBI:5525) is a monosaccharide derivative (CHEBI:63367) |
| gossypin (CHEBI:5525) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-1-benzopyran-8-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3,5,7,8,3',4'-Hexahydroxyflavone-8-glucoside | ChemIDplus |
| Gossypetin 8-O-glucoside | KEGG COMPOUND |
| Citations |
|---|