EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O8 |
| Net Charge | 0 |
| Average Mass | 318.237 |
| Monoisotopic Mass | 318.03757 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H |
| InChIKey | YRRAGUMVDQQZIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gossypetin (CHEBI:16400) has role plant metabolite (CHEBI:76924) |
| gossypetin (CHEBI:16400) is a 7-hydroxyflavonol (CHEBI:52267) |
| gossypetin (CHEBI:16400) is a hexahydroxyflavone (CHEBI:24561) |
| gossypetin (CHEBI:16400) is conjugate acid of gossypetin-3-olate (CHEBI:57759) |
| gossypetin (CHEBI:16400) is conjugate acid of gossypetin(1−) (CHEBI:77862) |
| Incoming Relation(s) |
| 2,3-dihydrogossypetin (CHEBI:16965) has functional parent gossypetin (CHEBI:16400) |
| 3,3',4',5,7-pentahydroxy-8-methoxyflavone (CHEBI:28018) has functional parent gossypetin (CHEBI:16400) |
| gossypetin 8-rhamnoside (CHEBI:28086) has functional parent gossypetin (CHEBI:16400) |
| gossypin (CHEBI:5525) has functional parent gossypetin (CHEBI:16400) |
| gossypetin-3-olate (CHEBI:57759) is conjugate base of gossypetin (CHEBI:16400) |
| gossypetin(1−) (CHEBI:77862) is conjugate base of gossypetin (CHEBI:16400) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,5,7,8-tetrahydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,3',4',5,7,8-Hexahydroxyflavone | KEGG COMPOUND |
| Articulatidin | ChemIDplus |
| Equisporol | ChEBI |
| Gossypetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04109 | KEGG COMPOUND |
| Gossypetin | Wikipedia |
| 334578-HEXAHYDROXYFLAVONE | MetaCyc |
| LMPK12113231 | LIPID MAPS |
| WO0103681 | Patent |
| JP55054883 | Patent |
| C00004721 | KNApSAcK |
| LSM-36971 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:332194 | Reaxys |
| CAS:489-35-0 | ChemIDplus |
| Citations |
|---|