EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28ClN3O5S |
| Net Charge | 0 |
| Average Mass | 494.013 |
| Monoisotopic Mass | 493.14382 |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H28ClN3O5S/c1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/h7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29) |
| InChIKey | ZNNLBTZKUZBEKO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor A EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of channel-conductance-controlling ATPase (EC 3.6.3.49, also known as cystic fibrosis conductance regulator, CFCR). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyburide (CHEBI:5441) has role anti-arrhythmia drug (CHEBI:38070) |
| glyburide (CHEBI:5441) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| glyburide (CHEBI:5441) has role EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor (CHEBI:131770) |
| glyburide (CHEBI:5441) has role hypoglycemic agent (CHEBI:35526) |
| glyburide (CHEBI:5441) is a N-sulfonylurea (CHEBI:76983) |
| glyburide (CHEBI:5441) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 5-chloro-N-(2-{4-[N-(N-cyclohexylcarbamoyl)sulfamoyl]phenyl}ethyl)-2-methoxybenzamide |
| INNs | Source |
|---|---|
| glibenclamida | DrugBank |
| glibenclamide | WHO MedNet |
| glibenclamide | KEGG DRUG |
| glibenclamidum | DrugBank |
| Synonyms | Source |
|---|---|
| 1-(p-(2-(5-chloro-2-methoxybenzamido)ethyl)benzenesulfonyl)-3-cyclohexylurea | ChemIDplus |
| 1-((p-(2-(5-chloro-o-anisamido)ethyl)phenyl)sulfonyl)-3-cyclohexylurea | ChemIDplus |
| 5-chloro-N-(2-(4-((((cyclohexylamino)carbonyl)amino)sulfonyl)phenyl)ethyl)-2-methoxybenzamide | ChemIDplus |
| Glyburide | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Diabeta | KEGG DRUG |
| Glynase | KEGG DRUG |
| Micronase | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2230085 | Beilstein |
| CAS:10238-21-8 | KEGG COMPOUND |
| CAS:10238-21-8 | ChemIDplus |
| Citations |
|---|