EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | C[C@H](O)C#CC#CC#CC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H20O3/c1-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h17,19H,4,6,8,10,12,14,16H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | MTWGWIOCIREVRF-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minquartynoic acid (CHEBI:542606) has role antimalarial (CHEBI:38068) |
| minquartynoic acid (CHEBI:542606) has role antineoplastic agent (CHEBI:35610) |
| minquartynoic acid (CHEBI:542606) has role antiviral agent (CHEBI:22587) |
| minquartynoic acid (CHEBI:542606) is a acetylenic fatty acid (CHEBI:25380) |
| minquartynoic acid (CHEBI:542606) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| minquartynoic acid (CHEBI:542606) is a long-chain fatty acid (CHEBI:15904) |
| minquartynoic acid (CHEBI:542606) is a straight-chain fatty acid (CHEBI:59202) |
| minquartynoic acid (CHEBI:542606) is a tetrayne (CHEBI:59834) |
| IUPAC Name |
|---|
| (17S)-17-hydroxyoctadeca-9,11,13,15-tetraynoic acid |
| Synonyms | Source |
|---|---|
| (S)-17-hydroxy-9,11,13,15-octadecatetraynoic acid | ChEBI |
| (S)-minquartynoic acid | ChEBI |
| minquartic acid | ChEBI |
| (−)-minquartynoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8721623 | Reaxys |
| CAS:123154-43-8 | ChemIDplus |
| Citations |
|---|