EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:542606 - minquartynoic acid
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | C[C@H](O)C#CC#CC#CC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H20O3/c1-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h17,19H,4,6,8,10,12,14,16H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | MTWGWIOCIREVRF-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minquartynoic acid (CHEBI:542606) has role antimalarial (CHEBI:38068) |
| minquartynoic acid (CHEBI:542606) has role antineoplastic agent (CHEBI:35610) |
| minquartynoic acid (CHEBI:542606) has role antiviral agent (CHEBI:22587) |
| minquartynoic acid (CHEBI:542606) is a acetylenic fatty acid (CHEBI:25380) |
| minquartynoic acid (CHEBI:542606) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| minquartynoic acid (CHEBI:542606) is a long-chain fatty acid (CHEBI:15904) |
| minquartynoic acid (CHEBI:542606) is a straight-chain fatty acid (CHEBI:59202) |
| minquartynoic acid (CHEBI:542606) is a tetrayne (CHEBI:59834) |
| IUPAC Name |
|---|
| (17S)-17-hydroxyoctadeca-9,11,13,15-tetraynoic acid |
| Synonyms | Source |
|---|---|
| (−)-minquartynoic acid | ChEBI |
| (S)-minquartynoic acid | ChEBI |
| (S)-17-hydroxy-9,11,13,15-octadecatetraynoic acid | ChEBI |
| minquartic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8721623 | Reaxys |
| CAS:123154-43-8 | ChemIDplus |
| Citations |
|---|