EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20NO10S2 |
| Net Charge | -1 |
| Average Mass | 402.423 |
| Monoisotopic Mass | 402.05341 |
| SMILES | C=CCC(O)CC(=NOS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H21NO10S2/c1-2-3-6(15)4-8(13-23-25(19,20)21)24-12-11(18)10(17)9(16)7(5-14)22-12/h2,6-7,9-12,14-18H,1,3-5H2,(H,19,20,21)/p-1/t6?,7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | ZEGLQSKFSKZGRO-IAYUFQOSSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gluconapoleiferin(1−) (CHEBI:5412) has functional parent glucobrassicanapin(1−) (CHEBI:5397) |
| gluconapoleiferin(1−) (CHEBI:5412) is a hydroxy-alkenylglucosinolate (CHEBI:62663) |
| gluconapoleiferin(1−) (CHEBI:5412) is conjugate base of gluconapoleiferin (CHEBI:79349) |
| Incoming Relation(s) |
| gluconapoleiferin (CHEBI:79349) is conjugate acid of gluconapoleiferin(1−) (CHEBI:5412) |
| IUPAC Name |
|---|
| 1-S-[3-hydroxy-N-(sulfonatooxy)hex-5-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-hydroxy-4-pentenylglucosinolate | ChEBI |
| 2-hydroxypent-4-enylglucosinolate | ChEBI |
| Gluconapoleiferin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08416 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:19764-03-5 | KEGG COMPOUND |