EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20NO9S2 |
| Net Charge | -1 |
| Average Mass | 386.424 |
| Monoisotopic Mass | 386.05850 |
| SMILES | C=CCCC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H21NO9S2/c1-2-3-4-5-8(13-22-24(18,19)20)23-12-11(17)10(16)9(15)7(6-14)21-12/h2,7,9-12,14-17H,1,3-6H2,(H,18,19,20)/p-1/b13-8-/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | XMJFVIGTHMOGNZ-AHMUMSBHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica rapa subsp. pekinensis (ncbitaxon:51351) | - | PubMed (24868877) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucobrassicanapin(1−) (CHEBI:5397) is a alkenylglucosinolate (CHEBI:36451) |
| glucobrassicanapin(1−) (CHEBI:5397) is conjugate base of glucobrassicanapin (CHEBI:79318) |
| Incoming Relation(s) |
| gluconapoleiferin(1−) (CHEBI:5412) has functional parent glucobrassicanapin(1−) (CHEBI:5397) |
| glucobrassicanapin (CHEBI:79318) is conjugate acid of glucobrassicanapin(1−) (CHEBI:5397) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfonatooxy)hex-5-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| pent-4-enylglucosinolate | ChEBI |
| 4-pentenylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08403 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5161206 | Reaxys |
| CAS:19041-10-2 | KEGG COMPOUND |