EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20NO9S3 |
| Net Charge | -1 |
| Average Mass | 406.480 |
| Monoisotopic Mass | 406.03057 |
| SMILES | CSCCC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO9S3/c1-22-4-2-3-7(12-21-24(17,18)19)23-11-10(16)9(15)8(14)6(5-13)20-11/h6,8-11,13-16H,2-5H2,1H3,(H,17,18,19)/p-1/b12-7-/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | ZCZCVJVUJGULMO-IIPHORNXSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eruca vesicaria subsp. sativa (ncbitaxon:29727) | - | PubMed (19489541) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoiberverin(1−) (CHEBI:5407) has functional parent propylglucosinolate (CHEBI:36446) |
| glucoiberverin(1−) (CHEBI:5407) is a ω-[(methylsulfanyl)alkyl]glucosinolate (CHEBI:136434) |
| glucoiberverin(1−) (CHEBI:5407) is conjugate base of glucoiberverin (CHEBI:79326) |
| Incoming Relation(s) |
| glucoiberverin (CHEBI:79326) is conjugate acid of glucoiberverin(1−) (CHEBI:5407) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-4-(methylsulfanyl)-N-(sulfonatooxy)butanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Glucoiberverin | KEGG COMPOUND |
| 3-methylthiopropylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08412 | KEGG COMPOUND |
| 3-METHYLTHIOPROPYL-GLUCOSINOLATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7726720 | Reaxys |
| CAS:26888-03-9 | KEGG COMPOUND |