EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18NO9S2 |
| Net Charge | -1 |
| Average Mass | 360.386 |
| Monoisotopic Mass | 360.04285 |
| SMILES | CCC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H19NO9S2/c1-2-3-6(11-20-22(16,17)18)21-10-9(15)8(14)7(13)5(4-12)19-10/h5,7-10,12-15H,2-4H2,1H3,(H,16,17,18)/p-1/b11-6-/t5-,7-,8+,9-,10+/m1/s1 |
| InChIKey | WFJBUHOMGSOMHL-GLVDENFASA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propylglucosinolate (CHEBI:36446) is a alkylglucosinolate (CHEBI:36445) |
| propylglucosinolate (CHEBI:36446) is conjugate base of propylglucosinolic acid (CHEBI:79341) |
| Incoming Relation(s) |
| glucocheirolin (CHEBI:5400) has functional parent propylglucosinolate (CHEBI:36446) |
| glucoiberin (CHEBI:5406) has functional parent propylglucosinolate (CHEBI:36446) |
| glucoiberverin(1−) (CHEBI:5407) has functional parent propylglucosinolate (CHEBI:36446) |
| propylglucosinolic acid (CHEBI:79341) is conjugate acid of propylglucosinolate (CHEBI:36446) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfonatooxy)butanimidoyl]-1-thio-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8799967 | Reaxys |
| Citations |
|---|