EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20NO10S2 |
| Net Charge | -1 |
| Average Mass | 390.412 |
| Monoisotopic Mass | 390.05341 |
| SMILES | CC(C)(O)CC(=NOS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO10S2/c1-11(2,17)3-6(12-22-24(18,19)20)23-10-9(16)8(15)7(14)5(4-13)21-10/h5,7-10,13-17H,3-4H2,1-2H3,(H,18,19,20)/p-1/t5-,7-,8+,9-,10+/m1/s1 |
| InChIKey | DYAQCRHEYVANDL-HOQQJHGQSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moringa stenopetala (ncbitaxon:161034) | - | PubMed (12709911) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoconringiin(1−) (CHEBI:5403) has functional parent isobutylglucosinolate (CHEBI:36447) |
| glucoconringiin(1−) (CHEBI:5403) is a hydroxy-alkylglucosinolate (CHEBI:62652) |
| glucoconringiin(1−) (CHEBI:5403) is conjugate base of glucoconringiin (CHEBI:79363) |
| Incoming Relation(s) |
| glucoconringiin (CHEBI:79363) is conjugate acid of glucoconringiin(1−) (CHEBI:5403) |
| IUPAC Name |
|---|
| 1-S-[3-hydroxy-3-methyl-N-(sulfonatooxy)butanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Glucoconringiin | KEGG COMPOUND |
| 2-hydroxy-2-methylpropylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08408 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:28463-28-7 | KEGG COMPOUND |