EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20NO9S2 |
| Net Charge | -1 |
| Average Mass | 374.413 |
| Monoisotopic Mass | 374.05850 |
| SMILES | CC(C)C/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO9S2/c1-5(2)3-7(12-21-23(17,18)19)22-11-10(16)9(15)8(14)6(4-13)20-11/h5-6,8-11,13-16H,3-4H2,1-2H3,(H,17,18,19)/p-1/b12-7-/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | SKLKAEFXBVWMJP-IIPHORNXSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutylglucosinolate (CHEBI:36447) is a alkylglucosinolate (CHEBI:36445) |
| isobutylglucosinolate (CHEBI:36447) is conjugate base of isobutylglucosinolic acid (CHEBI:79338) |
| Incoming Relation(s) |
| glucoconringiin(1−) (CHEBI:5403) has functional parent isobutylglucosinolate (CHEBI:36447) |
| isobutylglucosinolic acid (CHEBI:79338) is conjugate acid of isobutylglucosinolate (CHEBI:36447) |
| IUPAC Name |
|---|
| 1-S-[(1S)-3-methyl-N-(sulfonatooxy)butanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 2-methylpropylglucosinolate | ChEBI |