EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22NO10S2 |
| Net Charge | -1 |
| Average Mass | 404.439 |
| Monoisotopic Mass | 404.06906 |
| SMILES | CCC(C)(O)CC(=NOS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO10S2/c1-3-12(2,18)4-7(13-23-25(19,20)21)24-11-10(17)9(16)8(15)6(5-14)22-11/h6,8-11,14-18H,3-5H2,1-2H3,(H,19,20,21)/p-1/t6-,8-,9+,10-,11+,12?/m1/s1 |
| InChIKey | JEOJIKMFKHSAJU-IGHGXYNPSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucocleomin(1−) (CHEBI:5401) has functional parent 2-methylbutylglucosinolate (CHEBI:36449) |
| glucocleomin(1−) (CHEBI:5401) is a hydroxy-alkylglucosinolate (CHEBI:62652) |
| glucocleomin(1−) (CHEBI:5401) is conjugate base of glucocleomin (CHEBI:79362) |
| Incoming Relation(s) |
| glucocleomin (CHEBI:79362) is conjugate acid of glucocleomin(1−) (CHEBI:5401) |
| IUPAC Name |
|---|
| 1-S-[3-hydroxy-3-methyl-N-(sulfonatooxy)pentanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2-methylbutylglucosinolate | IUPAC |
| 2-Hydroxy-2-methylbutyl glucosinolate | KEGG COMPOUND |