EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22NO9S2 |
| Net Charge | -1 |
| Average Mass | 388.440 |
| Monoisotopic Mass | 388.07415 |
| SMILES | CCC(C)C/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO9S2/c1-3-6(2)4-8(13-22-24(18,19)20)23-12-11(17)10(16)9(15)7(5-14)21-12/h6-7,9-12,14-17H,3-5H2,1-2H3,(H,18,19,20)/p-1/b13-8-/t6?,7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | SPOQDEMWLUGCEW-VCAXDSDXSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutylglucosinolate (CHEBI:36449) is a alkylglucosinolate (CHEBI:36445) |
| 2-methylbutylglucosinolate (CHEBI:36449) is conjugate base of 2-methylbutylglucosinolic acid (CHEBI:79335) |
| Incoming Relation(s) |
| glucocleomin(1−) (CHEBI:5401) has functional parent 2-methylbutylglucosinolate (CHEBI:36449) |
| 2-methylbutylglucosinolic acid (CHEBI:79335) is conjugate acid of 2-methylbutylglucosinolate (CHEBI:36449) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-3-methyl-N-(sulfonatooxy)pentanimidoyl]-1-thio-β-D-glucopyranose |
| Citations |
|---|