EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5INO5 |
| Net Charge | -1 |
| Average Mass | 322.034 |
| Monoisotopic Mass | 321.92179 |
| SMILES | O=C([O-])Cc1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6INO5/c9-5-1-4(3-7(11)12)2-6(8(5)13)10(14)15/h1-2,13H,3H2,(H,11,12)/p-1 |
| InChIKey | KPWFDZXSCIFGNO-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxy-5-iodo-3-nitrophenyl)acetate (CHEBI:53799) is a monocarboxylic acid anion (CHEBI:35757) |
| (4-hydroxy-5-iodo-3-nitrophenyl)acetate (CHEBI:53799) is conjugate base of (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) |
| Incoming Relation(s) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) is conjugate acid of (4-hydroxy-5-iodo-3-nitrophenyl)acetate (CHEBI:53799) |
| IUPAC Name |
|---|
| (4-hydroxy-3-iodo-5-nitrophenyl)acetate |
| Synonyms | Source |
|---|---|
| nitrohydroxyiodophenylacetate | ChEBI |
| 2-(4-hydroxy-3-iodo-5-nitrophenyl)acetate | ChEBI |